C17H34N2O2 — CID 54571044
(1,2,2,6,6-pentamethylpiperidin-4-yl) N-hexylcarbamate (PubChem CID 54571044) has the molecular formula C17H34N2O2 and a molecular weight of 298.47 g/mol. Its IUPAC name is (1,2,2,6,6-pentamethylpiperidin-4-yl) N-hexylcarbamate.
| Compound Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) N-hexylcarbamate |
|---|---|
| PubChem CID | 54571044 |
| Molecular Formula | C17H34N2O2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.26 |
| IUPAC Name | (1,2,2,6,6-pentamethylpiperidin-4-yl) N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C17H34N2O2/c1-7-8-9-10-11-18-15(20)21-14-12-16(2,3)19(6)17(4,5)13-14/h14H,7-13H2,1-6H3,(H,18,20) |
| InChIKey | ZXGQKCYSROKECC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|