About cyclopropyl N-butylcarbamate
cyclopropyl N-butylcarbamate (PubChem CID 165447718) has the molecular formula C8H15NO2
and a molecular weight of 157.21 g/mol. Its IUPAC name is cyclopropyl N-butylcarbamate.
Molecular Properties
| Compound Name | cyclopropyl N-butylcarbamate |
| PubChem CID | 165447718 |
| Molecular Formula | C8H15NO2 |
| Molecular Weight | 157.21 g/mol |
| Exact Mass | 157.11 |
| IUPAC Name | cyclopropyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OC1CC1 |
| InChI | InChI=1S/C8H15NO2/c1-2-3-6-9-8(10)11-7-4-5-7/h7H,2-6H2,1H3,(H,9,10) |
| InChIKey | COQHIVGFIOGHTM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.21 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl N-butylcarbamate?
The IUPAC name of cyclopropyl N-butylcarbamate (CID 165447718) is cyclopropyl N-butylcarbamate.
What is the SMILES notation for cyclopropyl N-butylcarbamate?
The canonical SMILES for cyclopropyl N-butylcarbamate is CCCCNC(=O)OC1CC1.
What is the InChIKey of cyclopropyl N-butylcarbamate?
The InChIKey is COQHIVGFIOGHTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2/c1-2-3-6-9-8(10)11-7-4-5-7/h7H,2-6H2,1H3,(H,9,10).
What are the key properties of cyclopropyl N-butylcarbamate?
cyclopropyl N-butylcarbamate has a molecular weight of 157.21 g/mol, XLogP of 1.68, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl N-butylcarbamate is sourced from PubChem (CID 165447718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).