About (3-aminocyclopentyl) N-propylcarbamate
(3-aminocyclopentyl) N-propylcarbamate (PubChem CID 79464809) has the molecular formula C9H18N2O2
and a molecular weight of 186.25 g/mol. Its IUPAC name is (3-aminocyclopentyl) N-propylcarbamate.
Molecular Properties
| Compound Name | (3-aminocyclopentyl) N-propylcarbamate |
| PubChem CID | 79464809 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | (3-aminocyclopentyl) N-propylcarbamate |
| SMILES | CCCNC(=O)OC1CCC(N)C1 |
| InChI | InChI=1S/C9H18N2O2/c1-2-5-11-9(12)13-8-4-3-7(10)6-8/h7-8H,2-6,10H2,1H3,(H,11,12) |
| InChIKey | NERATAWNXZIXRV-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-aminocyclopentyl) N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclopentyl) N-propylcarbamate?
The IUPAC name of (3-aminocyclopentyl) N-propylcarbamate (CID 79464809) is (3-aminocyclopentyl) N-propylcarbamate.
What is the SMILES notation for (3-aminocyclopentyl) N-propylcarbamate?
The canonical SMILES for (3-aminocyclopentyl) N-propylcarbamate is CCCNC(=O)OC1CCC(N)C1.
What is the InChIKey of (3-aminocyclopentyl) N-propylcarbamate?
The InChIKey is NERATAWNXZIXRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2/c1-2-5-11-9(12)13-8-4-3-7(10)6-8/h7-8H,2-6,10H2,1H3,(H,11,12).
What are the key properties of (3-aminocyclopentyl) N-propylcarbamate?
(3-aminocyclopentyl) N-propylcarbamate has a molecular weight of 186.25 g/mol, XLogP of 1.00, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclopentyl) N-propylcarbamate is sourced from PubChem (CID 79464809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).