C14H24N2O6 — CID 175006721
bis[(1R,3S)-3-aminocyclopentyl] 2,3-dihydroxybutanedioate (PubChem CID 175006721) has the molecular formula C14H24N2O6 and a molecular weight of 316.35 g/mol. Its IUPAC name is bis[(1R,3S)-3-aminocyclopentyl] 2,3-dihydroxybutanedioate.
| Compound Name | bis[(1R,3S)-3-aminocyclopentyl] 2,3-dihydroxybutanedioate |
|---|---|
| PubChem CID | 175006721 |
| Molecular Formula | C14H24N2O6 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | bis[(1R,3S)-3-aminocyclopentyl] 2,3-dihydroxybutanedioate |
| SMILES | N[C@H]1CC[C@@H](OC(=O)C(O)C(O)C(=O)O[C@@H]2CC[C@H](N)C2)C1 |
| InChI | InChI=1S/C14H24N2O6/c15-7-1-3-9(5-7)21-13(19)11(17)12(18)14(20)22-10-4-2-8(16)6-10/h7-12,17-18H,1-6,15-16H2/t7-,8-,9+,10+,11?,12?/m0/s1 |
| InChIKey | FNSNSSUBAHGWMD-DNVZHSBJSA-N |
| XLogP | -1.45 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |