About (3-aminocyclohexyl) pyrrolidine-1-carboxylate
(3-aminocyclohexyl) pyrrolidine-1-carboxylate (PubChem CID 79465438) has the molecular formula C11H20N2O2
and a molecular weight of 212.29 g/mol. Its IUPAC name is (3-aminocyclohexyl) pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | (3-aminocyclohexyl) pyrrolidine-1-carboxylate |
| PubChem CID | 79465438 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | (3-aminocyclohexyl) pyrrolidine-1-carboxylate |
| SMILES | NC1CCCC(OC(=O)N2CCCC2)C1 |
| InChI | InChI=1S/C11H20N2O2/c12-9-4-3-5-10(8-9)15-11(14)13-6-1-2-7-13/h9-10H,1-8,12H2 |
| InChIKey | BSNSWHGYACNBSO-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-aminocyclohexyl) pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-aminocyclohexyl) pyrrolidine-1-carboxylate?
The IUPAC name of (3-aminocyclohexyl) pyrrolidine-1-carboxylate (CID 79465438) is (3-aminocyclohexyl) pyrrolidine-1-carboxylate.
What is the SMILES notation for (3-aminocyclohexyl) pyrrolidine-1-carboxylate?
The canonical SMILES for (3-aminocyclohexyl) pyrrolidine-1-carboxylate is NC1CCCC(OC(=O)N2CCCC2)C1.
What is the InChIKey of (3-aminocyclohexyl) pyrrolidine-1-carboxylate?
The InChIKey is BSNSWHGYACNBSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c12-9-4-3-5-10(8-9)15-11(14)13-6-1-2-7-13/h9-10H,1-8,12H2.
What are the key properties of (3-aminocyclohexyl) pyrrolidine-1-carboxylate?
(3-aminocyclohexyl) pyrrolidine-1-carboxylate has a molecular weight of 212.29 g/mol, XLogP of 1.49, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-aminocyclohexyl) pyrrolidine-1-carboxylate is sourced from PubChem (CID 79465438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).