C10H17NO3 — CID 101426040
[(1R,2S)-2-hydroxycyclopentyl] pyrrolidine-1-carboxylate (PubChem CID 101426040) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycyclopentyl] pyrrolidine-1-carboxylate.
| Compound Name | [(1R,2S)-2-hydroxycyclopentyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 101426040 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | [(1R,2S)-2-hydroxycyclopentyl] pyrrolidine-1-carboxylate |
| SMILES | O=C(O[C@@H]1CCC[C@@H]1O)N1CCCC1 |
| InChI | InChI=1S/C10H17NO3/c12-8-4-3-5-9(8)14-10(13)11-6-1-2-7-11/h8-9,12H,1-7H2/t8-,9+/m0/s1 |
| InChIKey | SSADQCYLQKHAEM-DTWKUNHWSA-N |
| XLogP | 1.13 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |