About [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate
[(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate (PubChem CID 11424413) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate |
| PubChem CID | 11424413 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate |
| SMILES | O=C(O[C@@H]1CCCC[C@@H]1O)N1CCCC1 |
| InChI | InChI=1S/C11H19NO3/c13-9-5-1-2-6-10(9)15-11(14)12-7-3-4-8-12/h9-10,13H,1-8H2/t9-,10+/m0/s1 |
| InChIKey | PKNFZEMZVABKRU-VHSXEESVSA-N |
| XLogP | 1.52 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate?
The IUPAC name of [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate (CID 11424413) is [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate.
What is the SMILES notation for [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate?
The canonical SMILES for [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate is O=C(O[C@@H]1CCCC[C@@H]1O)N1CCCC1.
What is the InChIKey of [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate?
The InChIKey is PKNFZEMZVABKRU-VHSXEESVSA-N. The full InChI is InChI=1S/C11H19NO3/c13-9-5-1-2-6-10(9)15-11(14)12-7-3-4-8-12/h9-10,13H,1-8H2/t9-,10+/m0/s1.
What are the key properties of [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate?
[(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-hydroxycyclohexyl] pyrrolidine-1-carboxylate is sourced from PubChem (CID 11424413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).