C12H21NO3 — CID 102024660
[(1R,2S)-2-hydroxycycloheptyl] pyrrolidine-1-carboxylate (PubChem CID 102024660) has the molecular formula C12H21NO3 and a molecular weight of 227.30 g/mol. Its IUPAC name is [(1R,2S)-2-hydroxycycloheptyl] pyrrolidine-1-carboxylate.
| Compound Name | [(1R,2S)-2-hydroxycycloheptyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102024660 |
| Molecular Formula | C12H21NO3 |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | [(1R,2S)-2-hydroxycycloheptyl] pyrrolidine-1-carboxylate |
| SMILES | O=C(O[C@@H]1CCCCC[C@@H]1O)N1CCCC1 |
| InChI | InChI=1S/C12H21NO3/c14-10-6-2-1-3-7-11(10)16-12(15)13-8-4-5-9-13/h10-11,14H,1-9H2/t10-,11+/m0/s1 |
| InChIKey | GAFYSQKRKPUNDB-WDEREUQCSA-N |
| XLogP | 1.91 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |