About 2-cyclohexylpropan-2-yl piperidine-1-carboxylate
2-cyclohexylpropan-2-yl piperidine-1-carboxylate (PubChem CID 59148790) has the molecular formula C15H27NO2
and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-cyclohexylpropan-2-yl piperidine-1-carboxylate.
Molecular Properties
| Compound Name | 2-cyclohexylpropan-2-yl piperidine-1-carboxylate |
| PubChem CID | 59148790 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-cyclohexylpropan-2-yl piperidine-1-carboxylate |
| SMILES | CC(C)(OC(=O)N1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H27NO2/c1-15(2,13-9-5-3-6-10-13)18-14(17)16-11-7-4-8-12-16/h13H,3-12H2,1-2H3 |
| InChIKey | RRKHUPQZKYWFJQ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexylpropan-2-yl piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexylpropan-2-yl piperidine-1-carboxylate?
The IUPAC name of 2-cyclohexylpropan-2-yl piperidine-1-carboxylate (CID 59148790) is 2-cyclohexylpropan-2-yl piperidine-1-carboxylate.
What is the SMILES notation for 2-cyclohexylpropan-2-yl piperidine-1-carboxylate?
The canonical SMILES for 2-cyclohexylpropan-2-yl piperidine-1-carboxylate is CC(C)(OC(=O)N1CCCCC1)C1CCCCC1.
What is the InChIKey of 2-cyclohexylpropan-2-yl piperidine-1-carboxylate?
The InChIKey is RRKHUPQZKYWFJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27NO2/c1-15(2,13-9-5-3-6-10-13)18-14(17)16-11-7-4-8-12-16/h13H,3-12H2,1-2H3.
What are the key properties of 2-cyclohexylpropan-2-yl piperidine-1-carboxylate?
2-cyclohexylpropan-2-yl piperidine-1-carboxylate has a molecular weight of 253.39 g/mol, XLogP of 3.97, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexylpropan-2-yl piperidine-1-carboxylate is sourced from PubChem (CID 59148790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).