C10H18N2O2 — CID 131024600
cyclobutyl 4-methylpiperazine-1-carboxylate (PubChem CID 131024600) has the molecular formula C10H18N2O2 and a molecular weight of 198.27 g/mol. Its IUPAC name is cyclobutyl 4-methylpiperazine-1-carboxylate.
| Compound Name | cyclobutyl 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 131024600 |
| Molecular Formula | C10H18N2O2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | cyclobutyl 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)OC2CCC2)CC1 |
| InChI | InChI=1S/C10H18N2O2/c1-11-5-7-12(8-6-11)10(13)14-9-3-2-4-9/h9H,2-8H2,1H3 |
| InChIKey | HPMGOZDPDOYNJJ-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |