C20H29N3O4 — CID 142677588
[4-[(2S)-2-amino-3-cyclopentyloxy-3-oxopropyl]phenyl] 4-methylpiperazine-1-carboxylate (PubChem CID 142677588) has the molecular formula C20H29N3O4 and a molecular weight of 375.47 g/mol. Its IUPAC name is [4-[(2S)-2-amino-3-cyclopentyloxy-3-oxopropyl]phenyl] 4-methylpiperazine-1-carboxylate.
| Compound Name | [4-[(2S)-2-amino-3-cyclopentyloxy-3-oxopropyl]phenyl] 4-methylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 142677588 |
| Molecular Formula | C20H29N3O4 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | [4-[(2S)-2-amino-3-cyclopentyloxy-3-oxopropyl]phenyl] 4-methylpiperazine-1-carboxylate |
| SMILES | CN1CCN(C(=O)Oc2ccc(C[C@H](N)C(=O)OC3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H29N3O4/c1-22-10-12-23(13-11-22)20(25)27-17-8-6-15(7-9-17)14-18(21)19(24)26-16-4-2-3-5-16/h6-9,16,18H,2-5,10-14,21H2,1H3/t18-/m0/s1 |
| InChIKey | IQQSFAUFPCOFNG-SFHVURJKSA-N |
| XLogP | 1.79 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |