C14H20N2O3 — CID 89421681
(4-methoxyphenyl) 4-methyl-1,4-diazepane-1-carboxylate (PubChem CID 89421681) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is (4-methoxyphenyl) 4-methyl-1,4-diazepane-1-carboxylate.
| Compound Name | (4-methoxyphenyl) 4-methyl-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 89421681 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | (4-methoxyphenyl) 4-methyl-1,4-diazepane-1-carboxylate |
| SMILES | COc1ccc(OC(=O)N2CCCN(C)CC2)cc1 |
| InChI | InChI=1S/C14H20N2O3/c1-15-8-3-9-16(11-10-15)14(17)19-13-6-4-12(18-2)5-7-13/h4-7H,3,8-11H2,1-2H3 |
| InChIKey | WUHVFKQHEMFRQA-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |