About cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride
cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride (PubChem CID 69387169) has the molecular formula C13H18ClNO2
and a molecular weight of 255.75 g/mol. Its IUPAC name is cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride.
Molecular Properties
| Compound Name | cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride |
| PubChem CID | 69387169 |
| Molecular Formula | C13H18ClNO2 |
| Molecular Weight | 255.75 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride |
| SMILES | Cl.NC(Cc1ccccc1)C(=O)OC1CCC1 |
| InChI | InChI=1S/C13H17NO2.ClH/c14-12(9-10-5-2-1-3-6-10)13(15)16-11-7-4-8-11;/h1-3,5-6,11-12H,4,7-9,14H2;1H |
| InChIKey | RACTWZDKLMVBBI-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.75 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride?
The IUPAC name of cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride (CID 69387169) is cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride.
What is the SMILES notation for cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride?
The canonical SMILES for cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride is Cl.NC(Cc1ccccc1)C(=O)OC1CCC1.
What is the InChIKey of cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride?
The InChIKey is RACTWZDKLMVBBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17NO2.ClH/c14-12(9-10-5-2-1-3-6-10)13(15)16-11-7-4-8-11;/h1-3,5-6,11-12H,4,7-9,14H2;1H.
What are the key properties of cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride?
cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride has a molecular weight of 255.75 g/mol, XLogP of 2.07, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclobutyl 2-amino-3-phenylpropanoate;hydrochloride is sourced from PubChem (CID 69387169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).