About bis(1-methylpiperidin-4-yl) carbonate;hydrochloride
bis(1-methylpiperidin-4-yl) carbonate;hydrochloride (PubChem CID 175100790) has the molecular formula C13H25ClN2O3
and a molecular weight of 292.81 g/mol. Its IUPAC name is bis(1-methylpiperidin-4-yl) carbonate;hydrochloride.
Molecular Properties
| Compound Name | bis(1-methylpiperidin-4-yl) carbonate;hydrochloride |
| PubChem CID | 175100790 |
| Molecular Formula | C13H25ClN2O3 |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | bis(1-methylpiperidin-4-yl) carbonate;hydrochloride |
| SMILES | CN1CCC(OC(=O)OC2CCN(C)CC2)CC1.Cl |
| InChI | InChI=1S/C13H24N2O3.ClH/c1-14-7-3-11(4-8-14)17-13(16)18-12-5-9-15(2)10-6-12;/h11-12H,3-10H2,1-2H3;1H |
| InChIKey | QMCSNYIZBAOQRU-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(1-methylpiperidin-4-yl) carbonate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-methylpiperidin-4-yl) carbonate;hydrochloride?
The IUPAC name of bis(1-methylpiperidin-4-yl) carbonate;hydrochloride (CID 175100790) is bis(1-methylpiperidin-4-yl) carbonate;hydrochloride.
What is the SMILES notation for bis(1-methylpiperidin-4-yl) carbonate;hydrochloride?
The canonical SMILES for bis(1-methylpiperidin-4-yl) carbonate;hydrochloride is CN1CCC(OC(=O)OC2CCN(C)CC2)CC1.Cl.
What is the InChIKey of bis(1-methylpiperidin-4-yl) carbonate;hydrochloride?
The InChIKey is QMCSNYIZBAOQRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O3.ClH/c1-14-7-3-11(4-8-14)17-13(16)18-12-5-9-15(2)10-6-12;/h11-12H,3-10H2,1-2H3;1H.
What are the key properties of bis(1-methylpiperidin-4-yl) carbonate;hydrochloride?
bis(1-methylpiperidin-4-yl) carbonate;hydrochloride has a molecular weight of 292.81 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-methylpiperidin-4-yl) carbonate;hydrochloride is sourced from PubChem (CID 175100790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).