About (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate
(1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate (PubChem CID 3063992) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate.
Molecular Properties
| Compound Name | (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate |
| PubChem CID | 3063992 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate |
| SMILES | CC#CC(O)(C#CC)C(=O)OC1CCN(C)CC1 |
| InChI | InChI=1S/C14H19NO3/c1-4-8-14(17,9-5-2)13(16)18-12-6-10-15(3)11-7-12/h12,17H,6-7,10-11H2,1-3H3 |
| InChIKey | PJWQCCFSMZZYBL-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate?
The IUPAC name of (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate (CID 3063992) is (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate.
What is the SMILES notation for (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate?
The canonical SMILES for (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate is CC#CC(O)(C#CC)C(=O)OC1CCN(C)CC1.
What is the InChIKey of (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate?
The InChIKey is PJWQCCFSMZZYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3/c1-4-8-14(17,9-5-2)13(16)18-12-6-10-15(3)11-7-12/h12,17H,6-7,10-11H2,1-3H3.
What are the key properties of (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate?
(1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate has a molecular weight of 249.31 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylpiperidin-4-yl) 2-hydroxy-2-prop-1-ynylpent-3-ynoate is sourced from PubChem (CID 3063992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).