C21H28N2O2 — CID 68972419
(1-methylpiperidin-4-yl) 2-(4-cyanophenyl)-2-cyclopentylpropanoate (PubChem CID 68972419) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-(4-cyanophenyl)-2-cyclopentylpropanoate.
| Compound Name | (1-methylpiperidin-4-yl) 2-(4-cyanophenyl)-2-cyclopentylpropanoate |
|---|---|
| PubChem CID | 68972419 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-(4-cyanophenyl)-2-cyclopentylpropanoate |
| SMILES | CN1CCC(OC(=O)C(C)(c2ccc(C#N)cc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C21H28N2O2/c1-21(17-5-3-4-6-17,18-9-7-16(15-22)8-10-18)20(24)25-19-11-13-23(2)14-12-19/h7-10,17,19H,3-6,11-14H2,1-2H3 |
| InChIKey | PVNSSVBBCSXIIC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |