C27H34INO4 — CID 21436127
[1-cyclopentyl-2-(1-methylpiperidin-4-yl)oxy-2-oxo-1-phenylethyl] benzoate;iodomethane (PubChem CID 21436127) has the molecular formula C27H34INO4 and a molecular weight of 563.48 g/mol. Its IUPAC name is [1-cyclopentyl-2-(1-methylpiperidin-4-yl)oxy-2-oxo-1-phenylethyl] benzoate;iodomethane.
| Compound Name | [1-cyclopentyl-2-(1-methylpiperidin-4-yl)oxy-2-oxo-1-phenylethyl] benzoate;iodomethane |
|---|---|
| PubChem CID | 21436127 |
| Molecular Formula | C27H34INO4 |
| Molecular Weight | 563.48 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | [1-cyclopentyl-2-(1-methylpiperidin-4-yl)oxy-2-oxo-1-phenylethyl] benzoate;iodomethane |
| SMILES | CI.CN1CCC(OC(=O)C(OC(=O)c2ccccc2)(c2ccccc2)C2CCCC2)CC1 |
| InChI | InChI=1S/C26H31NO4.CH3I/c1-27-18-16-23(17-19-27)30-25(29)26(22-14-8-9-15-22,21-12-6-3-7-13-21)31-24(28)20-10-4-2-5-11-20;1-2/h2-7,10-13,22-23H,8-9,14-19H2,1H3;1H3 |
| InChIKey | GRFWVURKMUTJGT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.48 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|