C27H42NO4+ — CID 90466742
[1-cyclopentyl-2-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-2-oxo-1-phenylethyl] octanoate (PubChem CID 90466742) has the molecular formula C27H42NO4+ and a molecular weight of 444.64 g/mol. Its IUPAC name is [1-cyclopentyl-2-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-2-oxo-1-phenylethyl] octanoate.
| Compound Name | [1-cyclopentyl-2-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-2-oxo-1-phenylethyl] octanoate |
|---|---|
| PubChem CID | 90466742 |
| Molecular Formula | C27H42NO4+ |
| Molecular Weight | 444.64 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | [1-cyclopentyl-2-(1,1-dimethylpyrrolidin-1-ium-3-yl)oxy-2-oxo-1-phenylethyl] octanoate |
| SMILES | CCCCCCCC(=O)OC(C(=O)OC1CC[N+](C)(C)C1)(c1ccccc1)C1CCCC1 |
| InChI | InChI=1S/C27H42NO4/c1-4-5-6-7-11-18-25(29)32-27(23-16-12-13-17-23,22-14-9-8-10-15-22)26(30)31-24-19-20-28(2,3)21-24/h8-10,14-15,23-24H,4-7,11-13,16-21H2,1-3H3/q+1 |
| InChIKey | KLUFOEBLWXKZBJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.64 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|