C28H44BrNO5 — CID 11570314
[1-methyl-1-(2-octoxy-2-oxoethyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide (PubChem CID 11570314) has the molecular formula C28H44BrNO5 and a molecular weight of 554.57 g/mol. Its IUPAC name is [1-methyl-1-(2-octoxy-2-oxoethyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide.
| Compound Name | [1-methyl-1-(2-octoxy-2-oxoethyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
|---|---|
| PubChem CID | 11570314 |
| Molecular Formula | C28H44BrNO5 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 553.24 |
| IUPAC Name | [1-methyl-1-(2-octoxy-2-oxoethyl)pyrrolidin-1-ium-3-yl] (2R)-2-cyclopentyl-2-hydroxy-2-phenylacetate bromide |
| SMILES | CCCCCCCCOC(=O)C[N+]1(C)CCC(OC(=O)[C@](O)(c2ccccc2)C2CCCC2)C1.[Br-] |
| InChI | InChI=1S/C28H44NO5.BrH/c1-3-4-5-6-7-13-20-33-26(30)22-29(2)19-18-25(21-29)34-27(31)28(32,24-16-11-12-17-24)23-14-9-8-10-15-23;/h8-10,14-15,24-25,32H,3-7,11-13,16-22H2,1-2H3;1H/q+1;/p-1/t25?,28-,29?;/m0./s1 |
| InChIKey | CCJFMGVZQISCHN-IQQGIHLUSA-M |
| XLogP | 1.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|