C19H31NO3 — CID 13371161
(1-methylpiperidin-4-yl) 2-cyclohexyl-2-hydroxy-5-methylhex-3-ynoate (PubChem CID 13371161) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is (1-methylpiperidin-4-yl) 2-cyclohexyl-2-hydroxy-5-methylhex-3-ynoate.
| Compound Name | (1-methylpiperidin-4-yl) 2-cyclohexyl-2-hydroxy-5-methylhex-3-ynoate |
|---|---|
| PubChem CID | 13371161 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | (1-methylpiperidin-4-yl) 2-cyclohexyl-2-hydroxy-5-methylhex-3-ynoate |
| SMILES | CC(C)C#CC(O)(C(=O)OC1CCN(C)CC1)C1CCCCC1 |
| InChI | InChI=1S/C19H31NO3/c1-15(2)9-12-19(22,16-7-5-4-6-8-16)18(21)23-17-10-13-20(3)14-11-17/h15-17,22H,4-8,10-11,13-14H2,1-3H3 |
| InChIKey | XNBPBUAKXFCLSF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|