C16H26O6 — CID 67760146
3-cyclohexyl-4-cyclohexyloxy-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 67760146) has the molecular formula C16H26O6 and a molecular weight of 314.38 g/mol. Its IUPAC name is 3-cyclohexyl-4-cyclohexyloxy-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 3-cyclohexyl-4-cyclohexyloxy-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 67760146 |
| Molecular Formula | C16H26O6 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 3-cyclohexyl-4-cyclohexyloxy-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | O=C(O)C(O)C(O)(C(=O)OC1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C16H26O6/c17-13(14(18)19)16(21,11-7-3-1-4-8-11)15(20)22-12-9-5-2-6-10-12/h11-13,17,21H,1-10H2,(H,18,19) |
| InChIKey | AQGTWLGLABVGTP-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |