C13H24O3 — CID 79303151
2-cyclooctyl-2-hydroxy-3-methylbutanoic acid (PubChem CID 79303151) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is 2-cyclooctyl-2-hydroxy-3-methylbutanoic acid.
| Compound Name | 2-cyclooctyl-2-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 79303151 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | 2-cyclooctyl-2-hydroxy-3-methylbutanoic acid |
| SMILES | CC(C)C(O)(C(=O)O)C1CCCCCCC1 |
| InChI | InChI=1S/C13H24O3/c1-10(2)13(16,12(14)15)11-8-6-4-3-5-7-9-11/h10-11,16H,3-9H2,1-2H3,(H,14,15) |
| InChIKey | CLEDLDYCCXTHLV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |