C18H32O4 — CID 175057284
2,3-ditert-butyl-2-cyclohexylbutanedioic acid (PubChem CID 175057284) has the molecular formula C18H32O4 and a molecular weight of 312.45 g/mol. Its IUPAC name is 2,3-ditert-butyl-2-cyclohexylbutanedioic acid.
| Compound Name | 2,3-ditert-butyl-2-cyclohexylbutanedioic acid |
|---|---|
| PubChem CID | 175057284 |
| Molecular Formula | C18H32O4 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.23 |
| IUPAC Name | 2,3-ditert-butyl-2-cyclohexylbutanedioic acid |
| SMILES | CC(C)(C)C(C(=O)O)C(C(=O)O)(C1CCCCC1)C(C)(C)C |
| InChI | InChI=1S/C18H32O4/c1-16(2,3)13(14(19)20)18(15(21)22,17(4,5)6)12-10-8-7-9-11-12/h12-13H,7-11H2,1-6H3,(H,19,20)(H,21,22) |
| InChIKey | LHIOOIJVTAIOBS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |