C11H20O4 — CID 106824703
2-(3-ethoxycyclobutyl)-2-hydroxy-3-methylbutanoic acid (PubChem CID 106824703) has the molecular formula C11H20O4 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(3-ethoxycyclobutyl)-2-hydroxy-3-methylbutanoic acid.
| Compound Name | 2-(3-ethoxycyclobutyl)-2-hydroxy-3-methylbutanoic acid |
|---|---|
| PubChem CID | 106824703 |
| Molecular Formula | C11H20O4 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 2-(3-ethoxycyclobutyl)-2-hydroxy-3-methylbutanoic acid |
| SMILES | CCOC1CC(C(O)(C(=O)O)C(C)C)C1 |
| InChI | InChI=1S/C11H20O4/c1-4-15-9-5-8(6-9)11(14,7(2)3)10(12)13/h7-9,14H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | JAFNACFEDXFBEB-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |