C14H23NO6 — CID 107831676
(2R)-2-[[2-(3-ethoxycyclobutyl)acetyl]amino]hexanedioic acid (PubChem CID 107831676) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is (2R)-2-[[2-(3-ethoxycyclobutyl)acetyl]amino]hexanedioic acid.
| Compound Name | (2R)-2-[[2-(3-ethoxycyclobutyl)acetyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 107831676 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | (2R)-2-[[2-(3-ethoxycyclobutyl)acetyl]amino]hexanedioic acid |
| SMILES | CCOC1CC(CC(=O)N[C@H](CCCC(=O)O)C(=O)O)C1 |
| InChI | InChI=1S/C14H23NO6/c1-2-21-10-6-9(7-10)8-12(16)15-11(14(19)20)4-3-5-13(17)18/h9-11H,2-8H2,1H3,(H,15,16)(H,17,18)(H,19,20)/t9?,10?,11-/m1/s1 |
| InChIKey | QPBPJETVNSWUKD-VQXHTEKXSA-N |
| XLogP | 1.02 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |