About azane;cyclohexyl hydrogen carbonate
azane;cyclohexyl hydrogen carbonate (PubChem CID 67723937) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is azane;cyclohexyl hydrogen carbonate.
Molecular Properties
| Compound Name | azane;cyclohexyl hydrogen carbonate |
| PubChem CID | 67723937 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | azane;cyclohexyl hydrogen carbonate |
| SMILES | N.O=C(O)OC1CCCCC1 |
| InChI | InChI=1S/C7H12O3.H3N/c8-7(9)10-6-4-2-1-3-5-6;/h6H,1-5H2,(H,8,9);1H3 |
| InChIKey | YBOMRAUZGJUSSC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;cyclohexyl hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;cyclohexyl hydrogen carbonate?
The IUPAC name of azane;cyclohexyl hydrogen carbonate (CID 67723937) is azane;cyclohexyl hydrogen carbonate.
What is the SMILES notation for azane;cyclohexyl hydrogen carbonate?
The canonical SMILES for azane;cyclohexyl hydrogen carbonate is N.O=C(O)OC1CCCCC1.
What is the InChIKey of azane;cyclohexyl hydrogen carbonate?
The InChIKey is YBOMRAUZGJUSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O3.H3N/c8-7(9)10-6-4-2-1-3-5-6;/h6H,1-5H2,(H,8,9);1H3.
What are the key properties of azane;cyclohexyl hydrogen carbonate?
azane;cyclohexyl hydrogen carbonate has a molecular weight of 161.20 g/mol, XLogP of 2.18, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;cyclohexyl hydrogen carbonate is sourced from PubChem (CID 67723937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).