About [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate
[(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate (PubChem CID 57178626) has the molecular formula C8H12O6
and a molecular weight of 204.18 g/mol. Its IUPAC name is [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate.
Molecular Properties
| Compound Name | [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate |
| PubChem CID | 57178626 |
| Molecular Formula | C8H12O6 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate |
| SMILES | O=C(O)O[C@H]1CCCC[C@H]1OC(=O)O |
| InChI | InChI=1S/C8H12O6/c9-7(10)13-5-3-1-2-4-6(5)14-8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6+ |
| InChIKey | QYMNRPRSDJVXRI-OLQVQODUSA-N |
| XLogP | 1.69 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate?
The IUPAC name of [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate (CID 57178626) is [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate.
What is the SMILES notation for [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate?
The canonical SMILES for [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate is O=C(O)O[C@H]1CCCC[C@H]1OC(=O)O.
What is the InChIKey of [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate?
The InChIKey is QYMNRPRSDJVXRI-OLQVQODUSA-N. The full InChI is InChI=1S/C8H12O6/c9-7(10)13-5-3-1-2-4-6(5)14-8(11)12/h5-6H,1-4H2,(H,9,10)(H,11,12)/t5-,6+.
What are the key properties of [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate?
[(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate has a molecular weight of 204.18 g/mol, XLogP of 1.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-carboxyoxycyclohexyl] hydrogen carbonate is sourced from PubChem (CID 57178626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).