C14H18O12 — CID 89439908
(4,5,8-tricarboxyoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) hydrogen carbonate (PubChem CID 89439908) has the molecular formula C14H18O12 and a molecular weight of 378.29 g/mol. Its IUPAC name is (4,5,8-tricarboxyoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) hydrogen carbonate.
| Compound Name | (4,5,8-tricarboxyoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) hydrogen carbonate |
|---|---|
| PubChem CID | 89439908 |
| Molecular Formula | C14H18O12 |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | (4,5,8-tricarboxyoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-yl) hydrogen carbonate |
| SMILES | O=C(O)OC1CCC(OC(=O)O)C2C(OC(=O)O)CCC(OC(=O)O)C12 |
| InChI | InChI=1S/C14H18O12/c15-11(16)23-5-1-2-6(24-12(17)18)10-8(26-14(21)22)4-3-7(9(5)10)25-13(19)20/h5-10H,1-4H2,(H,15,16)(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | VMTKTOIOBITPFI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 186.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|