About dicyclononyl carbonate
dicyclononyl carbonate (PubChem CID 139618210) has the molecular formula C19H34O3
and a molecular weight of 310.48 g/mol. Its IUPAC name is dicyclononyl carbonate.
Molecular Properties
| Compound Name | dicyclononyl carbonate |
| PubChem CID | 139618210 |
| Molecular Formula | C19H34O3 |
| Molecular Weight | 310.48 g/mol |
| Exact Mass | 310.25 |
| IUPAC Name | dicyclononyl carbonate |
| SMILES | O=C(OC1CCCCCCCC1)OC1CCCCCCCC1 |
| InChI | InChI=1S/C19H34O3/c20-19(21-17-13-9-5-1-2-6-10-14-17)22-18-15-11-7-3-4-8-12-16-18/h17-18H,1-16H2 |
| InChIKey | IMQOAPBIJDRINE-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dicyclononyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclononyl carbonate?
The IUPAC name of dicyclononyl carbonate (CID 139618210) is dicyclononyl carbonate.
What is the SMILES notation for dicyclononyl carbonate?
The canonical SMILES for dicyclononyl carbonate is O=C(OC1CCCCCCCC1)OC1CCCCCCCC1.
What is the InChIKey of dicyclononyl carbonate?
The InChIKey is IMQOAPBIJDRINE-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O3/c20-19(21-17-13-9-5-1-2-6-10-14-17)22-18-15-11-7-3-4-8-12-16-18/h17-18H,1-16H2.
What are the key properties of dicyclononyl carbonate?
dicyclononyl carbonate has a molecular weight of 310.48 g/mol, XLogP of 6.15, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclononyl carbonate is sourced from PubChem (CID 139618210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).