cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate

C23H42O2Si — CID 173470117

IUPACcyclohexyl 2,3-dicyclohexyl-2-silylpentanoate
SMILESCCC(C1CCCCC1)C([SiH3])(C(=O)OC1CCCCC1)C1CCCCC1
InChIInChI=1S/C23H42O2Si/c1-2-21(18-12-6-3-7-13-18)23(26,19-14-8-4-9-15-19)22(24)25-20-16-10-5-11-17-20/h18-21H,2-17H2,1,26H3
InChIKeyCVWRIELJNOYKAW-UHFFFAOYSA-N
MW378.67 g/mol
LogP5.57
Rot. Bonds6

About cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate

cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate (PubChem CID 173470117) has the molecular formula C23H42O2Si and a molecular weight of 378.67 g/mol. Its IUPAC name is cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate.

Molecular Properties

Compound Namecyclohexyl 2,3-dicyclohexyl-2-silylpentanoate
PubChem CID173470117
Molecular FormulaC23H42O2Si
Molecular Weight378.67 g/mol
Exact Mass378.30
IUPAC Namecyclohexyl 2,3-dicyclohexyl-2-silylpentanoate
SMILESCCC(C1CCCCC1)C([SiH3])(C(=O)OC1CCCCC1)C1CCCCC1
InChIInChI=1S/C23H42O2Si/c1-2-21(18-12-6-3-7-13-18)23(26,19-14-8-4-9-15-19)22(24)25-20-16-10-5-11-17-20/h18-21H,2-17H2,1,26H3
InChIKeyCVWRIELJNOYKAW-UHFFFAOYSA-N
XLogP5.57
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms26
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500378.67
LogP ≤ 55.57
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate?
The IUPAC name of cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate (CID 173470117) is cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate.
What is the SMILES notation for cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate?
The canonical SMILES for cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate is CCC(C1CCCCC1)C([SiH3])(C(=O)OC1CCCCC1)C1CCCCC1.
What is the InChIKey of cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate?
The InChIKey is CVWRIELJNOYKAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H42O2Si/c1-2-21(18-12-6-3-7-13-18)23(26,19-14-8-4-9-15-19)22(24)25-20-16-10-5-11-17-20/h18-21H,2-17H2,1,26H3.
What are the key properties of cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate?
cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate has a molecular weight of 378.67 g/mol, XLogP of 5.57, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl 2,3-dicyclohexyl-2-silylpentanoate is sourced from PubChem (CID 173470117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).