C22H41BO3 — CID 67766211
1,1,2-tricyclohexylbutoxyboronic acid (PubChem CID 67766211) has the molecular formula C22H41BO3 and a molecular weight of 364.38 g/mol. Its IUPAC name is 1,1,2-tricyclohexylbutoxyboronic acid.
| Compound Name | 1,1,2-tricyclohexylbutoxyboronic acid |
|---|---|
| PubChem CID | 67766211 |
| Molecular Formula | C22H41BO3 |
| Molecular Weight | 364.38 g/mol |
| Exact Mass | 364.31 |
| IUPAC Name | 1,1,2-tricyclohexylbutoxyboronic acid |
| SMILES | CCC(C1CCCCC1)C(OB(O)O)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C22H41BO3/c1-2-21(18-12-6-3-7-13-18)22(26-23(24)25,19-14-8-4-9-15-19)20-16-10-5-11-17-20/h18-21,24-25H,2-17H2,1H3 |
| InChIKey | QMULXHGQXIHDGC-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.38 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|