C17H25NO4 — CID 86602260
[(3R)-1-methylpyrrolidin-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate (PubChem CID 86602260) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is [(3R)-1-methylpyrrolidin-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate.
| Compound Name | [(3R)-1-methylpyrrolidin-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 86602260 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | [(3R)-1-methylpyrrolidin-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate |
| SMILES | CN1CC[C@@H](OC(=O)C(O)(c2ccco2)C2CCCCC2)C1 |
| InChI | InChI=1S/C17H25NO4/c1-18-10-9-14(12-18)22-16(19)17(20,15-8-5-11-21-15)13-6-3-2-4-7-13/h5,8,11,13-14,20H,2-4,6-7,9-10,12H2,1H3/t14-,17?/m1/s1 |
| InChIKey | DLNMCMHIKNDISL-XPCCGILXSA-N |
| XLogP | 2.29 |
| TPSA | 62.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |