C28H36F3NO7 — CID 10415286
[1-methyl-1-(2-phenylmethoxyethyl)pyrrolidin-1-ium-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate;2,2,2-trifluoroacetate (PubChem CID 10415286) has the molecular formula C28H36F3NO7 and a molecular weight of 555.59 g/mol. Its IUPAC name is [1-methyl-1-(2-phenylmethoxyethyl)pyrrolidin-1-ium-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate;2,2,2-trifluoroacetate.
| Compound Name | [1-methyl-1-(2-phenylmethoxyethyl)pyrrolidin-1-ium-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 10415286 |
| Molecular Formula | C28H36F3NO7 |
| Molecular Weight | 555.59 g/mol |
| Exact Mass | 555.24 |
| IUPAC Name | [1-methyl-1-(2-phenylmethoxyethyl)pyrrolidin-1-ium-3-yl] 2-cyclohexyl-2-(furan-2-yl)-2-hydroxyacetate;2,2,2-trifluoroacetate |
| SMILES | C[N+]1(CCOCc2ccccc2)CCC(OC(=O)C(O)(c2ccco2)C2CCCCC2)C1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C26H36NO5.C2HF3O2/c1-27(16-18-30-20-21-9-4-2-5-10-21)15-14-23(19-27)32-25(28)26(29,24-13-8-17-31-24)22-11-6-3-7-12-22;3-2(4,5)1(6)7/h2,4-5,8-10,13,17,22-23,29H,3,6-7,11-12,14-16,18-20H2,1H3;(H,6,7)/q+1;/p-1 |
| InChIKey | XWBBJXDVOGDBCP-UHFFFAOYSA-M |
| XLogP | 3.33 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.59 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|