C20H39NO7S — CID 142542065
(4-sulfanylcyclohexyl) N-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 142542065) has the molecular formula C20H39NO7S and a molecular weight of 437.60 g/mol. Its IUPAC name is (4-sulfanylcyclohexyl) N-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | (4-sulfanylcyclohexyl) N-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142542065 |
| Molecular Formula | C20H39NO7S |
| Molecular Weight | 437.60 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | (4-sulfanylcyclohexyl) N-[2-[2-[2-[2-(2-propoxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CCCOCCOCCOCCOCCOCCNC(=O)OC1CCC(S)CC1 |
| InChI | InChI=1S/C20H39NO7S/c1-2-8-23-10-12-25-14-16-27-17-15-26-13-11-24-9-7-21-20(22)28-18-3-5-19(29)6-4-18/h18-19,29H,2-17H2,1H3,(H,21,22) |
| InChIKey | GEFCJFQFOZYKLM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.60 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|