C25H52N2O7S — CID 142541752
ethane;3-methylbutanal;(4-sulfanylcyclohexyl) N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 142541752) has the molecular formula C25H52N2O7S and a molecular weight of 524.77 g/mol. Its IUPAC name is ethane;3-methylbutanal;(4-sulfanylcyclohexyl) N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | ethane;3-methylbutanal;(4-sulfanylcyclohexyl) N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142541752 |
| Molecular Formula | C25H52N2O7S |
| Molecular Weight | 524.77 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | ethane;3-methylbutanal;(4-sulfanylcyclohexyl) N-[2-[2-[2-[2-[2-(methylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC.CC(C)CC=O.CNCCOCCOCCOCCOCCNC(=O)OC1CCC(S)CC1 |
| InChI | InChI=1S/C18H36N2O6S.C5H10O.C2H6/c1-19-6-8-22-10-12-24-14-15-25-13-11-23-9-7-20-18(21)26-16-2-4-17(27)5-3-16;1-5(2)3-4-6;1-2/h16-17,19,27H,2-15H2,1H3,(H,20,21);4-5H,3H2,1-2H3;1-2H3 |
| InChIKey | AFCOEMXYGYQPKD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.77 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|