C23H43NO9S — CID 142542016
2-[2-[2-[2-[2-[2-[(4-sulfanylcyclohexyl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl butanoate (PubChem CID 142542016) has the molecular formula C23H43NO9S and a molecular weight of 509.66 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[(4-sulfanylcyclohexyl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl butanoate.
| Compound Name | 2-[2-[2-[2-[2-[2-[(4-sulfanylcyclohexyl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl butanoate |
|---|---|
| PubChem CID | 142542016 |
| Molecular Formula | C23H43NO9S |
| Molecular Weight | 509.66 g/mol |
| Exact Mass | 509.27 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[(4-sulfanylcyclohexyl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl butanoate |
| SMILES | CCCC(=O)OCCOCCOCCOCCOCCOCCNC(=O)OC1CCC(S)CC1 |
| InChI | InChI=1S/C23H43NO9S/c1-2-3-22(25)32-19-18-31-17-16-30-15-14-29-13-12-28-11-10-27-9-8-24-23(26)33-20-4-6-21(34)7-5-20/h20-21,34H,2-19H2,1H3,(H,24,26) |
| InChIKey | IMEYJOORCSBWJI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.66 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|