C21H45NO5S — CID 142541779
molecular hydrogen;propane;(4-sulfanylcyclohexyl) N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]carbamate (PubChem CID 142541779) has the molecular formula C21H45NO5S and a molecular weight of 423.66 g/mol. Its IUPAC name is molecular hydrogen;propane;(4-sulfanylcyclohexyl) N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]carbamate.
| Compound Name | molecular hydrogen;propane;(4-sulfanylcyclohexyl) N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142541779 |
| Molecular Formula | C21H45NO5S |
| Molecular Weight | 423.66 g/mol |
| Exact Mass | 423.30 |
| IUPAC Name | molecular hydrogen;propane;(4-sulfanylcyclohexyl) N-[2-[2-(3-oxobutoxy)ethoxy]ethyl]carbamate |
| SMILES | CC(=O)CCOCCOCCNC(=O)OC1CCC(S)CC1.CCC.CCC.[H][H] |
| InChI | InChI=1S/C15H27NO5S.2C3H8.H2/c1-12(17)6-8-19-10-11-20-9-7-16-15(18)21-13-2-4-14(22)5-3-13;2*1-3-2;/h13-14,22H,2-11H2,1H3,(H,16,18);2*3H2,1-2H3;1H |
| InChIKey | KLMQSKRITZZABD-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.66 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|