C21H38N2O6S — CID 142542081
(4-propan-2-ylsulfanylcyclohexyl) N-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl]carbamate (PubChem CID 142542081) has the molecular formula C21H38N2O6S and a molecular weight of 446.61 g/mol. Its IUPAC name is (4-propan-2-ylsulfanylcyclohexyl) N-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | (4-propan-2-ylsulfanylcyclohexyl) N-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 142542081 |
| Molecular Formula | C21H38N2O6S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | (4-propan-2-ylsulfanylcyclohexyl) N-[2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC(=O)CCC(=O)NCCOCCOCCNC(=O)OC1CCC(SC(C)C)CC1 |
| InChI | InChI=1S/C21H38N2O6S/c1-16(2)30-19-7-5-18(6-8-19)29-21(26)23-11-13-28-15-14-27-12-10-22-20(25)9-4-17(3)24/h16,18-19H,4-15H2,1-3H3,(H,22,25)(H,23,26) |
| InChIKey | IAYZJSLUFKJPFG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|