C20H36N2O6S — CID 142541904
2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl N-(4-ethylsulfanylcyclohexyl)carbamate (PubChem CID 142541904) has the molecular formula C20H36N2O6S and a molecular weight of 432.58 g/mol. Its IUPAC name is 2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl N-(4-ethylsulfanylcyclohexyl)carbamate.
| Compound Name | 2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl N-(4-ethylsulfanylcyclohexyl)carbamate |
|---|---|
| PubChem CID | 142541904 |
| Molecular Formula | C20H36N2O6S |
| Molecular Weight | 432.58 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-[2-[2-(4-oxopentanoylamino)ethoxy]ethoxy]ethyl N-(4-ethylsulfanylcyclohexyl)carbamate |
| SMILES | CCSC1CCC(NC(=O)OCCOCCOCCNC(=O)CCC(C)=O)CC1 |
| InChI | InChI=1S/C20H36N2O6S/c1-3-29-18-7-5-17(6-8-18)22-20(25)28-15-14-27-13-12-26-11-10-21-19(24)9-4-16(2)23/h17-18H,3-15H2,1-2H3,(H,21,24)(H,22,25) |
| InChIKey | LPIZNOWRTWABPZ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.58 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|