C21H37NO8S — CID 138468898
2-[2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethyl 4-oxopentanoate (PubChem CID 138468898) has the molecular formula C21H37NO8S and a molecular weight of 463.59 g/mol. Its IUPAC name is 2-[2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethyl 4-oxopentanoate.
| Compound Name | 2-[2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethyl 4-oxopentanoate |
|---|---|
| PubChem CID | 138468898 |
| Molecular Formula | C21H37NO8S |
| Molecular Weight | 463.59 g/mol |
| Exact Mass | 463.22 |
| IUPAC Name | 2-[2-[2-[2-[(4-methylsulfanylcyclohexyl)carbamoyloxy]ethoxy]ethoxy]ethoxy]ethyl 4-oxopentanoate |
| SMILES | CSC1CCC(NC(=O)OCCOCCOCCOCCOC(=O)CCC(C)=O)CC1 |
| InChI | InChI=1S/C21H37NO8S/c1-17(23)3-8-20(24)29-15-13-27-11-9-26-10-12-28-14-16-30-21(25)22-18-4-6-19(31-2)7-5-18/h18-19H,3-16H2,1-2H3,(H,22,25) |
| InChIKey | NRUDMCZMRKOKSP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.59 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|