C18H31NO10 — CID 118135667
2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]oxyethoxy]ethoxy]ethyl 4-oxopentanoate (PubChem CID 118135667) has the molecular formula C18H31NO10 and a molecular weight of 421.44 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]oxyethoxy]ethoxy]ethyl 4-oxopentanoate.
| Compound Name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]oxyethoxy]ethoxy]ethyl 4-oxopentanoate |
|---|---|
| PubChem CID | 118135667 |
| Molecular Formula | C18H31NO10 |
| Molecular Weight | 421.44 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | 2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyacetyl]oxyethoxy]ethoxy]ethyl 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCCOCCOCCOC(=O)CONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO10/c1-14(20)5-6-15(21)26-11-9-24-7-8-25-10-12-27-16(22)13-28-19-17(23)29-18(2,3)4/h5-13H2,1-4H3,(H,19,23) |
| InChIKey | IDZQJCCZSNWAJY-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.44 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|