C13H28INO6S — CID 177228817
tert-butyl N-[2-[2-(2-iodosulfanyloxyethoxy)ethoxy]ethoxy]carbamate;ethane (PubChem CID 177228817) has the molecular formula C13H28INO6S and a molecular weight of 453.34 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-iodosulfanyloxyethoxy)ethoxy]ethoxy]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[2-(2-iodosulfanyloxyethoxy)ethoxy]ethoxy]carbamate;ethane |
|---|---|
| PubChem CID | 177228817 |
| Molecular Formula | C13H28INO6S |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | tert-butyl N-[2-[2-(2-iodosulfanyloxyethoxy)ethoxy]ethoxy]carbamate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)NOCCOCCOCCOSI |
| InChI | InChI=1S/C11H22INO6S.C2H6/c1-11(2,3)19-10(14)13-17-8-6-15-4-5-16-7-9-18-20-12;1-2/h4-9H2,1-3H3,(H,13,14);1-2H3 |
| InChIKey | NNBLRBSOIPGBEI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|