C33H70N4O8 — CID 145317467
tert-butyl N-[2-[2-[2-[bis[3-(3-amino-3-methylbutoxy)-3-methylbutyl]amino]-2-oxoethoxy]ethoxy]ethoxy]carbamate;ethane (PubChem CID 145317467) has the molecular formula C33H70N4O8 and a molecular weight of 650.94 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[bis[3-(3-amino-3-methylbutoxy)-3-methylbutyl]amino]-2-oxoethoxy]ethoxy]ethoxy]carbamate;ethane.
| Compound Name | tert-butyl N-[2-[2-[2-[bis[3-(3-amino-3-methylbutoxy)-3-methylbutyl]amino]-2-oxoethoxy]ethoxy]ethoxy]carbamate;ethane |
|---|---|
| PubChem CID | 145317467 |
| Molecular Formula | C33H70N4O8 |
| Molecular Weight | 650.94 g/mol |
| Exact Mass | 650.52 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[bis[3-(3-amino-3-methylbutoxy)-3-methylbutyl]amino]-2-oxoethoxy]ethoxy]ethoxy]carbamate;ethane |
| SMILES | CC.CC(C)(N)CCOC(C)(C)CCN(CCC(C)(C)OCCC(C)(C)N)C(=O)COCCOCCONC(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H64N4O8.C2H6/c1-27(2,3)43-26(37)34-42-23-22-38-20-21-39-24-25(36)35(16-12-30(8,9)40-18-14-28(4,5)32)17-13-31(10,11)41-19-15-29(6,7)33;1-2/h12-24,32-33H2,1-11H3,(H,34,37);1-2H3 |
| InChIKey | ZURJPGUVCNPCLF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 156.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.94 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|