C11H22INO5 — CID 59981200
tert-butyl N-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]carbamate (PubChem CID 59981200) has the molecular formula C11H22INO5 and a molecular weight of 375.20 g/mol. Its IUPAC name is tert-butyl N-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]carbamate |
|---|---|
| PubChem CID | 59981200 |
| Molecular Formula | C11H22INO5 |
| Molecular Weight | 375.20 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | tert-butyl N-[2-[2-(2-iodoethoxy)ethoxy]ethoxy]carbamate |
| SMILES | CC(C)(C)OC(=O)NOCCOCCOCCI |
| InChI | InChI=1S/C11H22INO5/c1-11(2,3)18-10(14)13-17-9-8-16-7-6-15-5-4-12/h4-9H2,1-3H3,(H,13,14) |
| InChIKey | ZRTBCJRHUUWIEG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|