C11H20BrNO5 — CID 86659550
2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl 2-bromo-2-methylpropanoate (PubChem CID 86659550) has the molecular formula C11H20BrNO5 and a molecular weight of 326.19 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl 2-bromo-2-methylpropanoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl 2-bromo-2-methylpropanoate |
|---|---|
| PubChem CID | 86659550 |
| Molecular Formula | C11H20BrNO5 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]oxyethyl 2-bromo-2-methylpropanoate |
| SMILES | CC(C)(C)OC(=O)NOCCOC(=O)C(C)(C)Br |
| InChI | InChI=1S/C11H20BrNO5/c1-10(2,3)18-9(15)13-17-7-6-16-8(14)11(4,5)12/h6-7H2,1-5H3,(H,13,15) |
| InChIKey | DTCNMIGZFKIWDM-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|