C23H49N3O6 — CID 145317544
tert-butyl N-[2-[2-[2-[[3-(3-amino-3-methylbutoxy)-3-methylbutyl]-ethylamino]ethoxy]ethoxy]ethoxy]carbamate (PubChem CID 145317544) has the molecular formula C23H49N3O6 and a molecular weight of 463.66 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[2-[[3-(3-amino-3-methylbutoxy)-3-methylbutyl]-ethylamino]ethoxy]ethoxy]ethoxy]carbamate.
| Compound Name | tert-butyl N-[2-[2-[2-[[3-(3-amino-3-methylbutoxy)-3-methylbutyl]-ethylamino]ethoxy]ethoxy]ethoxy]carbamate |
|---|---|
| PubChem CID | 145317544 |
| Molecular Formula | C23H49N3O6 |
| Molecular Weight | 463.66 g/mol |
| Exact Mass | 463.36 |
| IUPAC Name | tert-butyl N-[2-[2-[2-[[3-(3-amino-3-methylbutoxy)-3-methylbutyl]-ethylamino]ethoxy]ethoxy]ethoxy]carbamate |
| SMILES | CCN(CCOCCOCCONC(=O)OC(C)(C)C)CCC(C)(C)OCCC(C)(C)N |
| InChI | InChI=1S/C23H49N3O6/c1-9-26(12-10-23(7,8)30-14-11-22(5,6)24)13-15-28-16-17-29-18-19-31-25-20(27)32-21(2,3)4/h9-19,24H2,1-8H3,(H,25,27) |
| InChIKey | MSINIKGMFUAJMK-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.66 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|