C16H33NO3 — CID 167070130
2-methylbutan-2-yl 4-(3-amino-3-methylbutoxy)-4-methylpentanoate (PubChem CID 167070130) has the molecular formula C16H33NO3 and a molecular weight of 287.44 g/mol. Its IUPAC name is 2-methylbutan-2-yl 4-(3-amino-3-methylbutoxy)-4-methylpentanoate.
| Compound Name | 2-methylbutan-2-yl 4-(3-amino-3-methylbutoxy)-4-methylpentanoate |
|---|---|
| PubChem CID | 167070130 |
| Molecular Formula | C16H33NO3 |
| Molecular Weight | 287.44 g/mol |
| Exact Mass | 287.25 |
| IUPAC Name | 2-methylbutan-2-yl 4-(3-amino-3-methylbutoxy)-4-methylpentanoate |
| SMILES | CCC(C)(C)OC(=O)CCC(C)(C)OCCC(C)(C)N |
| InChI | InChI=1S/C16H33NO3/c1-8-15(4,5)20-13(18)9-10-16(6,7)19-12-11-14(2,3)17/h8-12,17H2,1-7H3 |
| InChIKey | WNIXBOAUROVJHD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.44 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |