About 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane
4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane (PubChem CID 156884875) has the molecular formula C15H33NO2
and a molecular weight of 259.43 g/mol. Its IUPAC name is 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane.
Molecular Properties
| Compound Name | 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane |
| PubChem CID | 156884875 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane |
| SMILES | CC.CCC(C)(C)CCOC(C)(C)CCC(N)=O |
| InChI | InChI=1S/C13H27NO2.C2H6/c1-6-12(2,3)9-10-16-13(4,5)8-7-11(14)15;1-2/h6-10H2,1-5H3,(H2,14,15);1-2H3 |
| InChIKey | NRFJKRBWWHITGF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane?
The IUPAC name of 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane (CID 156884875) is 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane.
What is the SMILES notation for 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane?
The canonical SMILES for 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane is CC.CCC(C)(C)CCOC(C)(C)CCC(N)=O.
What is the InChIKey of 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane?
The InChIKey is NRFJKRBWWHITGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2.C2H6/c1-6-12(2,3)9-10-16-13(4,5)8-7-11(14)15;1-2/h6-10H2,1-5H3,(H2,14,15);1-2H3.
What are the key properties of 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane?
4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane has a molecular weight of 259.43 g/mol, XLogP of 3.90, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane is sourced from PubChem (CID 156884875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).