C15H33NO2 — CID 156884875
4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane (PubChem CID 156884875) has the molecular formula C15H33NO2 and a molecular weight of 259.43 g/mol. Its IUPAC name is 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane.
| Compound Name | 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane |
|---|---|
| PubChem CID | 156884875 |
| Molecular Formula | C15H33NO2 |
| Molecular Weight | 259.43 g/mol |
| Exact Mass | 259.25 |
| IUPAC Name | 4-(3,3-dimethylpentoxy)-4-methylpentanamide;ethane |
| SMILES | CC.CCC(C)(C)CCOC(C)(C)CCC(N)=O |
| InChI | InChI=1S/C13H27NO2.C2H6/c1-6-12(2,3)9-10-16-13(4,5)8-7-11(14)15;1-2/h6-10H2,1-5H3,(H2,14,15);1-2H3 |
| InChIKey | NRFJKRBWWHITGF-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.43 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |