C12H25NO2 — CID 138571120
4-(2,4,4-trimethylpentan-2-yloxy)butanamide (PubChem CID 138571120) has the molecular formula C12H25NO2 and a molecular weight of 215.34 g/mol. Its IUPAC name is 4-(2,4,4-trimethylpentan-2-yloxy)butanamide.
| Compound Name | 4-(2,4,4-trimethylpentan-2-yloxy)butanamide |
|---|---|
| PubChem CID | 138571120 |
| Molecular Formula | C12H25NO2 |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.19 |
| IUPAC Name | 4-(2,4,4-trimethylpentan-2-yloxy)butanamide |
| SMILES | CC(C)(C)CC(C)(C)OCCCC(N)=O |
| InChI | InChI=1S/C12H25NO2/c1-11(2,3)9-12(4,5)15-8-6-7-10(13)14/h6-9H2,1-5H3,(H2,13,14) |
| InChIKey | DIKHMQHLSYQDKO-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|