C23H44O8 — CID 139639655
2,4,4-trimethylpentan-2-yloxy 5-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)pentyl carbonate (PubChem CID 139639655) has the molecular formula C23H44O8 and a molecular weight of 448.60 g/mol. Its IUPAC name is 2,4,4-trimethylpentan-2-yloxy 5-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)pentyl carbonate.
| Compound Name | 2,4,4-trimethylpentan-2-yloxy 5-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)pentyl carbonate |
|---|---|
| PubChem CID | 139639655 |
| Molecular Formula | C23H44O8 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | 2,4,4-trimethylpentan-2-yloxy 5-(2,4,4-trimethylpentan-2-ylperoxycarbonyloxy)pentyl carbonate |
| SMILES | CC(C)(C)CC(C)(C)OOC(=O)OCCCCCOC(=O)OOC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C23H44O8/c1-20(2,3)16-22(7,8)30-28-18(24)26-14-12-11-13-15-27-19(25)29-31-23(9,10)17-21(4,5)6/h11-17H2,1-10H3 |
| InChIKey | DJLCDTAFWQOYGT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|